C24H20Cl2F4N2O2 — CID 134222016
4-[(E)-3-(3-chloro-4-fluoro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-N-[(6-chloro-3-pyridinyl)methoxy]-2-methoxyaniline (PubChem CID 134222016) has the molecular formula C24H20Cl2F4N2O2 and a molecular weight of 515.33 g/mol. Its IUPAC name is 4-[(E)-3-(3-chloro-4-fluoro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-N-[(6-chloro-3-pyridinyl)methoxy]-2-methoxyaniline.
| Compound Name | 4-[(E)-3-(3-chloro-4-fluoro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-N-[(6-chloro-3-pyridinyl)methoxy]-2-methoxyaniline |
|---|---|
| PubChem CID | 134222016 |
| Molecular Formula | C24H20Cl2F4N2O2 |
| Molecular Weight | 515.33 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 4-[(E)-3-(3-chloro-4-fluoro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-N-[(6-chloro-3-pyridinyl)methoxy]-2-methoxyaniline |
| SMILES | COc1cc(/C=C/C(c2cc(C)c(F)c(Cl)c2)C(F)(F)F)ccc1NOCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C24H20Cl2F4N2O2/c1-14-9-17(11-19(25)23(14)27)18(24(28,29)30)6-3-15-4-7-20(21(10-15)33-2)32-34-13-16-5-8-22(26)31-12-16/h3-12,18,32H,13H2,1-2H3/b6-3+ |
| InChIKey | AZPHLXXODRSUQZ-ZZXKWVIFSA-N |
| XLogP | 7.75 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.33 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|