C20H17ClF3N5 — CID 134222082
N'-[4-[(E)-3-(3-chloro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-2-cyanophenyl]-N-(diaminomethylidene)methanimidamide (PubChem CID 134222082) has the molecular formula C20H17ClF3N5 and a molecular weight of 419.84 g/mol. Its IUPAC name is N'-[4-[(E)-3-(3-chloro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-2-cyanophenyl]-N-(diaminomethylidene)methanimidamide.
| Compound Name | N'-[4-[(E)-3-(3-chloro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-2-cyanophenyl]-N-(diaminomethylidene)methanimidamide |
|---|---|
| PubChem CID | 134222082 |
| Molecular Formula | C20H17ClF3N5 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N'-[4-[(E)-3-(3-chloro-5-methylphenyl)-4,4,4-trifluorobut-1-enyl]-2-cyanophenyl]-N-(diaminomethylidene)methanimidamide |
| SMILES | Cc1cc(Cl)cc(C(/C=C/c2ccc(/N=C/N=C(N)N)c(C#N)c2)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17ClF3N5/c1-12-6-14(9-16(21)7-12)17(20(22,23)24)4-2-13-3-5-18(15(8-13)10-25)28-11-29-19(26)27/h2-9,11,17H,1H3,(H4,26,27,28,29)/b4-2+ |
| InChIKey | UIWMTFMFRUXDHT-DUXPYHPUSA-N |
| XLogP | 4.81 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|