About 5-ethenyl-2,3-dihydroinden-1-imine
5-ethenyl-2,3-dihydroinden-1-imine (PubChem CID 134222162) has the molecular formula C11H11N
and a molecular weight of 157.22 g/mol. Its IUPAC name is 5-ethenyl-2,3-dihydroinden-1-imine.
Molecular Properties
| Compound Name | 5-ethenyl-2,3-dihydroinden-1-imine |
| PubChem CID | 134222162 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 5-ethenyl-2,3-dihydroinden-1-imine |
| SMILES | [H]/N=C1\CCc2cc(C=C)ccc21 |
| InChI | InChI=1S/C11H11N/c1-2-8-3-5-10-9(7-8)4-6-11(10)12/h2-3,5,7,12H,1,4,6H2/b12-11+ |
| InChIKey | XTZZROAFCODMIV-VAWYXSNFSA-N |
| XLogP | 2.64 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-2,3-dihydroinden-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-2,3-dihydroinden-1-imine?
The IUPAC name of 5-ethenyl-2,3-dihydroinden-1-imine (CID 134222162) is 5-ethenyl-2,3-dihydroinden-1-imine.
What is the SMILES notation for 5-ethenyl-2,3-dihydroinden-1-imine?
The canonical SMILES for 5-ethenyl-2,3-dihydroinden-1-imine is [H]/N=C1\CCc2cc(C=C)ccc21.
What is the InChIKey of 5-ethenyl-2,3-dihydroinden-1-imine?
The InChIKey is XTZZROAFCODMIV-VAWYXSNFSA-N. The full InChI is InChI=1S/C11H11N/c1-2-8-3-5-10-9(7-8)4-6-11(10)12/h2-3,5,7,12H,1,4,6H2/b12-11+.
What are the key properties of 5-ethenyl-2,3-dihydroinden-1-imine?
5-ethenyl-2,3-dihydroinden-1-imine has a molecular weight of 157.22 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-2,3-dihydroinden-1-imine is sourced from PubChem (CID 134222162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).