About 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene
2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene (PubChem CID 134222446) has the molecular formula C21H20F2
and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene.
Molecular Properties
| Compound Name | 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene |
| PubChem CID | 134222446 |
| Molecular Formula | C21H20F2 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene |
| SMILES | CC(C)(C)c1ccc2ccc(Cc3ccc(F)c(F)c3)cc2c1 |
| InChI | InChI=1S/C21H20F2/c1-21(2,3)18-8-7-16-6-4-14(11-17(16)13-18)10-15-5-9-19(22)20(23)12-15/h4-9,11-13H,10H2,1-3H3 |
| InChIKey | MPXPXOGPVHHAOM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene?
The IUPAC name of 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene (CID 134222446) is 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene.
What is the SMILES notation for 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene?
The canonical SMILES for 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene is CC(C)(C)c1ccc2ccc(Cc3ccc(F)c(F)c3)cc2c1.
What is the InChIKey of 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene?
The InChIKey is MPXPXOGPVHHAOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F2/c1-21(2,3)18-8-7-16-6-4-14(11-17(16)13-18)10-15-5-9-19(22)20(23)12-15/h4-9,11-13H,10H2,1-3H3.
What are the key properties of 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene?
2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene has a molecular weight of 310.39 g/mol, XLogP of 6.01, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-7-[(3,4-difluorophenyl)methyl]naphthalene is sourced from PubChem (CID 134222446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).