C34H39NO9 — CID 134222702
[(3S,4S)-4,5-diacetyloxy-4-(4-acetyloxyphenyl)-2-oxo-6-[(E)-2-[(1R,3S,4S)-1,3,4-trimethylcyclohexyl]ethenyl]-1,3-dihydroquinolin-3-yl] acetate (PubChem CID 134222702) has the molecular formula C34H39NO9 and a molecular weight of 605.68 g/mol. Its IUPAC name is [(3S,4S)-4,5-diacetyloxy-4-(4-acetyloxyphenyl)-2-oxo-6-[(E)-2-[(1R,3S,4S)-1,3,4-trimethylcyclohexyl]ethenyl]-1,3-dihydroquinolin-3-yl] acetate.
| Compound Name | [(3S,4S)-4,5-diacetyloxy-4-(4-acetyloxyphenyl)-2-oxo-6-[(E)-2-[(1R,3S,4S)-1,3,4-trimethylcyclohexyl]ethenyl]-1,3-dihydroquinolin-3-yl] acetate |
|---|---|
| PubChem CID | 134222702 |
| Molecular Formula | C34H39NO9 |
| Molecular Weight | 605.68 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | [(3S,4S)-4,5-diacetyloxy-4-(4-acetyloxyphenyl)-2-oxo-6-[(E)-2-[(1R,3S,4S)-1,3,4-trimethylcyclohexyl]ethenyl]-1,3-dihydroquinolin-3-yl] acetate |
| SMILES | CC(=O)Oc1ccc([C@]2(OC(C)=O)c3c(ccc(/C=C/[C@]4(C)CC[C@H](C)[C@@H](C)C4)c3OC(C)=O)NC(=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C34H39NO9/c1-19-14-16-33(7,18-20(19)2)17-15-25-8-13-28-29(30(25)42-22(4)37)34(44-24(6)39,31(32(40)35-28)43-23(5)38)26-9-11-27(12-10-26)41-21(3)36/h8-13,15,17,19-20,31H,14,16,18H2,1-7H3,(H,35,40)/b17-15+/t19-,20-,31+,33-,34-/m0/s1 |
| InChIKey | ZSNBQLHYJFHNHH-XUAQOSIRSA-N |
| XLogP | 5.70 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|