C32H31FN8O2S — CID 134222861
1-[2-[(2S,4R)-4-fluoro-2-[[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]amino]methyl]pyrrolidin-1-yl]-2-oxoethyl]-5-pyridazin-4-ylindazole-3-carboxamide (PubChem CID 134222861) has the molecular formula C32H31FN8O2S and a molecular weight of 610.72 g/mol. Its IUPAC name is 1-[2-[(2S,4R)-4-fluoro-2-[[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]amino]methyl]pyrrolidin-1-yl]-2-oxoethyl]-5-pyridazin-4-ylindazole-3-carboxamide.
| Compound Name | 1-[2-[(2S,4R)-4-fluoro-2-[[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]amino]methyl]pyrrolidin-1-yl]-2-oxoethyl]-5-pyridazin-4-ylindazole-3-carboxamide |
|---|---|
| PubChem CID | 134222861 |
| Molecular Formula | C32H31FN8O2S |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | 1-[2-[(2S,4R)-4-fluoro-2-[[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]amino]methyl]pyrrolidin-1-yl]-2-oxoethyl]-5-pyridazin-4-ylindazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CC(=O)N2C[C@H](F)C[C@H]2CNc2nc(-c3ccc4c(c3)CCCC4)cs2)c2ccc(-c3ccnnc3)cc12 |
| InChI | InChI=1S/C32H31FN8O2S/c33-24-13-25(15-35-32-38-27(18-44-32)22-6-5-19-3-1-2-4-20(19)11-22)40(16-24)29(42)17-41-28-8-7-21(23-9-10-36-37-14-23)12-26(28)30(39-41)31(34)43/h5-12,14,18,24-25H,1-4,13,15-17H2,(H2,34,43)(H,35,38)/t24-,25+/m1/s1 |
| InChIKey | RSNGTXSJNZAPST-RPBOFIJWSA-N |
| XLogP | 4.65 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |