C24H44O4 — CID 134223588
(2,4-dimethyl-4-prop-2-enoyloxypentan-2-yl) 2-hexyloctanoate (PubChem CID 134223588) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is (2,4-dimethyl-4-prop-2-enoyloxypentan-2-yl) 2-hexyloctanoate.
| Compound Name | (2,4-dimethyl-4-prop-2-enoyloxypentan-2-yl) 2-hexyloctanoate |
|---|---|
| PubChem CID | 134223588 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | (2,4-dimethyl-4-prop-2-enoyloxypentan-2-yl) 2-hexyloctanoate |
| SMILES | C=CC(=O)OC(C)(C)CC(C)(C)OC(=O)C(CCCCCC)CCCCCC |
| InChI | InChI=1S/C24H44O4/c1-8-11-13-15-17-20(18-16-14-12-9-2)22(26)28-24(6,7)19-23(4,5)27-21(25)10-3/h10,20H,3,8-9,11-19H2,1-2,4-7H3 |
| InChIKey | UYRTZMOHRZYENP-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|