C20H21N5OS — CID 134223767
(5-amino-7,11-dimethyl-3-thia-1,10,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl)-(2,3-dihydro-1H-inden-2-ylamino)methanol (PubChem CID 134223767) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is (5-amino-7,11-dimethyl-3-thia-1,10,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl)-(2,3-dihydro-1H-inden-2-ylamino)methanol.
| Compound Name | (5-amino-7,11-dimethyl-3-thia-1,10,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl)-(2,3-dihydro-1H-inden-2-ylamino)methanol |
|---|---|
| PubChem CID | 134223767 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (5-amino-7,11-dimethyl-3-thia-1,10,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl)-(2,3-dihydro-1H-inden-2-ylamino)methanol |
| SMILES | Cc1nc2cc(C)c3c(N)c(C(O)NC4Cc5ccccc5C4)sc3n2n1 |
| InChI | InChI=1S/C20H21N5OS/c1-10-7-15-22-11(2)24-25(15)20-16(10)17(21)18(27-20)19(26)23-14-8-12-5-3-4-6-13(12)9-14/h3-7,14,19,23,26H,8-9,21H2,1-2H3 |
| InChIKey | VTRQAYXXKSFZNX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|