About (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide
(Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide (PubChem CID 134224060) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide.
Molecular Properties
| Compound Name | (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide |
| PubChem CID | 134224060 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide |
| SMILES | C=N/C=C(\C=C/C)C(/N)=N/C |
| InChI | InChI=1S/C8H13N3/c1-4-5-7(6-10-2)8(9)11-3/h4-6H,2H2,1,3H3,(H2,9,11)/b5-4-,7-6+ |
| InChIKey | DMIPJZMBJPYENB-SCFJQAPRSA-N |
| XLogP | 1.13 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide?
The IUPAC name of (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide (CID 134224060) is (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide.
What is the SMILES notation for (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide?
The canonical SMILES for (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide is C=N/C=C(\C=C/C)C(/N)=N/C.
What is the InChIKey of (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide?
The InChIKey is DMIPJZMBJPYENB-SCFJQAPRSA-N. The full InChI is InChI=1S/C8H13N3/c1-4-5-7(6-10-2)8(9)11-3/h4-6H,2H2,1,3H3,(H2,9,11)/b5-4-,7-6+.
What are the key properties of (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide?
(Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide has a molecular weight of 151.21 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2E)-N'-methyl-2-[(methylideneamino)methylidene]pent-3-enimidamide is sourced from PubChem (CID 134224060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).