C24H31F5N4O — CID 134224693
[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(2,2-dimethylpropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanol (PubChem CID 134224693) has the molecular formula C24H31F5N4O and a molecular weight of 486.53 g/mol. Its IUPAC name is [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(2,2-dimethylpropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanol.
| Compound Name | [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(2,2-dimethylpropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 134224693 |
| Molecular Formula | C24H31F5N4O |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(2,2-dimethylpropyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]methanol |
| SMILES | CC(C)(C)CN1CCc2[nH]nc(C(O)N3CCC(c4ccc(F)c(F)c4C(F)(F)F)CC3)c2C1 |
| InChI | InChI=1S/C24H31F5N4O/c1-23(2,3)13-32-9-8-18-16(12-32)21(31-30-18)22(34)33-10-6-14(7-11-33)15-4-5-17(25)20(26)19(15)24(27,28)29/h4-5,14,22,34H,6-13H2,1-3H3,(H,30,31) |
| InChIKey | HYMFJOBBHYDKTQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |