C22H24F8N4O — CID 134224697
[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[6-(3,3,3-trifluoropropyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]methanol (PubChem CID 134224697) has the molecular formula C22H24F8N4O and a molecular weight of 512.45 g/mol. Its IUPAC name is [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[6-(3,3,3-trifluoropropyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]methanol.
| Compound Name | [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[6-(3,3,3-trifluoropropyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 134224697 |
| Molecular Formula | C22H24F8N4O |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[6-(3,3,3-trifluoropropyl)-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-3-yl]methanol |
| SMILES | OC(c1n[nH]c2c1CCN(CCC(F)(F)F)C2)N1CCC(c2ccc(F)c(F)c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H24F8N4O/c23-15-2-1-13(17(18(15)24)22(28,29)30)12-3-8-34(9-4-12)20(35)19-14-5-7-33(10-6-21(25,26)27)11-16(14)31-32-19/h1-2,12,20,35H,3-11H2,(H,31,32) |
| InChIKey | JNWZRQZOQUCUKS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |