C12H17N3 — CID 134224792
2-[(2E,4Z)-hepta-2,4-dien-2-yl]-4,6-dimethyl-1,3,5-triazine (PubChem CID 134224792) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-[(2E,4Z)-hepta-2,4-dien-2-yl]-4,6-dimethyl-1,3,5-triazine.
| Compound Name | 2-[(2E,4Z)-hepta-2,4-dien-2-yl]-4,6-dimethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134224792 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 2-[(2E,4Z)-hepta-2,4-dien-2-yl]-4,6-dimethyl-1,3,5-triazine |
| SMILES | CC/C=C\C=C(/C)c1nc(C)nc(C)n1 |
| InChI | InChI=1S/C12H17N3/c1-5-6-7-8-9(2)12-14-10(3)13-11(4)15-12/h6-8H,5H2,1-4H3/b7-6-,9-8+ |
| InChIKey | OPADWKOKPALSSS-NMMTYZSQSA-N |
| XLogP | 2.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|