C22H37N3 — CID 134224952
2-[(3Z,5E)-8,8-diethyl-2,2,9-trimethyldeca-3,5-dien-5-yl]-4,6-dimethyl-1,3,5-triazine (PubChem CID 134224952) has the molecular formula C22H37N3 and a molecular weight of 343.56 g/mol. Its IUPAC name is 2-[(3Z,5E)-8,8-diethyl-2,2,9-trimethyldeca-3,5-dien-5-yl]-4,6-dimethyl-1,3,5-triazine.
| Compound Name | 2-[(3Z,5E)-8,8-diethyl-2,2,9-trimethyldeca-3,5-dien-5-yl]-4,6-dimethyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134224952 |
| Molecular Formula | C22H37N3 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | 2-[(3Z,5E)-8,8-diethyl-2,2,9-trimethyldeca-3,5-dien-5-yl]-4,6-dimethyl-1,3,5-triazine |
| SMILES | CCC(CC)(C/C=C(\C=C/C(C)(C)C)c1nc(C)nc(C)n1)C(C)C |
| InChI | InChI=1S/C22H37N3/c1-10-22(11-2,16(3)4)15-13-19(12-14-21(7,8)9)20-24-17(5)23-18(6)25-20/h12-14,16H,10-11,15H2,1-9H3/b14-12-,19-13+ |
| InChIKey | DMYJCZLEYWNAPN-WROMKANLSA-N |
| XLogP | 6.33 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|