About 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide
4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide (PubChem CID 134225126) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide.
Molecular Properties
| Compound Name | 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide |
| PubChem CID | 134225126 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide |
| SMILES | C=CC(CC)C(C)C/C(N)=N/C(=C)/C=C\CC |
| InChI | InChI=1S/C15H26N2/c1-6-9-10-13(5)17-15(16)11-12(4)14(7-2)8-3/h7,9-10,12,14H,2,5-6,8,11H2,1,3-4H3,(H2,16,17)/b10-9- |
| InChIKey | YWKNWRROXNRPOY-KTKRTIGZSA-N |
| XLogP | 4.06 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide?
The IUPAC name of 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide (CID 134225126) is 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide.
What is the SMILES notation for 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide?
The canonical SMILES for 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide is C=CC(CC)C(C)C/C(N)=N/C(=C)/C=C\CC.
What is the InChIKey of 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide?
The InChIKey is YWKNWRROXNRPOY-KTKRTIGZSA-N. The full InChI is InChI=1S/C15H26N2/c1-6-9-10-13(5)17-15(16)11-12(4)14(7-2)8-3/h7,9-10,12,14H,2,5-6,8,11H2,1,3-4H3,(H2,16,17)/b10-9-.
What are the key properties of 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide?
4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide has a molecular weight of 234.39 g/mol, XLogP of 4.06, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N'-[(3Z)-hexa-1,3-dien-2-yl]-3-methylhex-5-enimidamide is sourced from PubChem (CID 134225126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).