C12H22F3NO2S — CID 134225287
4,4-diethyl-1-(3,3,3-trifluoropropylsulfonyl)piperidine (PubChem CID 134225287) has the molecular formula C12H22F3NO2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 4,4-diethyl-1-(3,3,3-trifluoropropylsulfonyl)piperidine.
| Compound Name | 4,4-diethyl-1-(3,3,3-trifluoropropylsulfonyl)piperidine |
|---|---|
| PubChem CID | 134225287 |
| Molecular Formula | C12H22F3NO2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4,4-diethyl-1-(3,3,3-trifluoropropylsulfonyl)piperidine |
| SMILES | CCC1(CC)CCN(S(=O)(=O)CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3NO2S/c1-3-11(4-2)5-8-16(9-6-11)19(17,18)10-7-12(13,14)15/h3-10H2,1-2H3 |
| InChIKey | PFRUJDDYXBTDHT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |