C20H16Cl2F3N5 — CID 134225406
N'-[2-cyano-4-[(E)-3-(3,5-dichloro-4-methylphenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-N-(diaminomethylidene)methanimidamide (PubChem CID 134225406) has the molecular formula C20H16Cl2F3N5 and a molecular weight of 454.28 g/mol. Its IUPAC name is N'-[2-cyano-4-[(E)-3-(3,5-dichloro-4-methylphenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-N-(diaminomethylidene)methanimidamide.
| Compound Name | N'-[2-cyano-4-[(E)-3-(3,5-dichloro-4-methylphenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-N-(diaminomethylidene)methanimidamide |
|---|---|
| PubChem CID | 134225406 |
| Molecular Formula | C20H16Cl2F3N5 |
| Molecular Weight | 454.28 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N'-[2-cyano-4-[(E)-3-(3,5-dichloro-4-methylphenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-N-(diaminomethylidene)methanimidamide |
| SMILES | Cc1c(Cl)cc(C(/C=C/c2ccc(/N=C/N=C(N)N)c(C#N)c2)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C20H16Cl2F3N5/c1-11-16(21)7-13(8-17(11)22)15(20(23,24)25)4-2-12-3-5-18(14(6-12)9-26)29-10-30-19(27)28/h2-8,10,15H,1H3,(H4,27,28,29,30)/b4-2+ |
| InChIKey | PZNSAZMCGSMUSM-DUXPYHPUSA-N |
| XLogP | 5.47 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.28 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|