C25H24ClF3N2OS — CID 134225601
N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trimethylphenyl)but-1-enyl]benzamide (PubChem CID 134225601) has the molecular formula C25H24ClF3N2OS and a molecular weight of 492.99 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trimethylphenyl)but-1-enyl]benzamide.
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trimethylphenyl)but-1-enyl]benzamide |
|---|---|
| PubChem CID | 134225601 |
| Molecular Formula | C25H24ClF3N2OS |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]-2-methyl-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trimethylphenyl)but-1-enyl]benzamide |
| SMILES | Cc1cc(/C=C/C(c2cc(C)c(C)c(C)c2)C(F)(F)F)ccc1C(=O)NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C25H24ClF3N2OS/c1-14-10-19(11-15(2)17(14)4)22(25(27,28)29)8-6-18-5-7-21(16(3)9-18)23(32)30-12-20-13-31-24(26)33-20/h5-11,13,22H,12H2,1-4H3,(H,30,32)/b8-6+ |
| InChIKey | KCZZYYNMQHIZLR-SOFGYWHQSA-N |
| XLogP | 7.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |