C19H15BrF4N2 — CID 134225741
1-(4-bromo-2,6-difluorophenyl)-2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 134225741) has the molecular formula C19H15BrF4N2 and a molecular weight of 427.24 g/mol. Its IUPAC name is 1-(4-bromo-2,6-difluorophenyl)-2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(4-bromo-2,6-difluorophenyl)-2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 134225741 |
| Molecular Formula | C19H15BrF4N2 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 1-(4-bromo-2,6-difluorophenyl)-2-(2,2-difluoroethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Fc1cc(Br)cc(F)c1C1c2[nH]c3ccccc3c2CCN1CC(F)F |
| InChI | InChI=1S/C19H15BrF4N2/c20-10-7-13(21)17(14(22)8-10)19-18-12(5-6-26(19)9-16(23)24)11-3-1-2-4-15(11)25-18/h1-4,7-8,16,19,25H,5-6,9H2 |
| InChIKey | ZAWNDDNSQSWJPA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|