C15H21NO — CID 134225935
2-[[(1E,3E,5E)-4,5-bis(ethenyl)octa-1,3,5,7-tetraenyl]amino]propan-2-ol (PubChem CID 134225935) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-[[(1E,3E,5E)-4,5-bis(ethenyl)octa-1,3,5,7-tetraenyl]amino]propan-2-ol.
| Compound Name | 2-[[(1E,3E,5E)-4,5-bis(ethenyl)octa-1,3,5,7-tetraenyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 134225935 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2-[[(1E,3E,5E)-4,5-bis(ethenyl)octa-1,3,5,7-tetraenyl]amino]propan-2-ol |
| SMILES | C=C/C=C(C=C)/C(C=C)=C/C=C/NC(C)(C)O |
| InChI | InChI=1S/C15H21NO/c1-6-10-13(7-2)14(8-3)11-9-12-16-15(4,5)17/h6-12,16-17H,1-3H2,4-5H3/b12-9+,13-10+,14-11+ |
| InChIKey | WWVFJOIVPYAZLA-TXCHTVKQSA-N |
| XLogP | 3.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|