About 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]
4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] (PubChem CID 134225945) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane].
Molecular Properties
| Compound Name | 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] |
| PubChem CID | 134225945 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] |
| SMILES | COc1cc(C)cc2c1C1(CC1)CO2 |
| InChI | InChI=1S/C12H14O2/c1-8-5-9(13-2)11-10(6-8)14-7-12(11)3-4-12/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | LDKLTDPWDXZJAD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
The IUPAC name of 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] (CID 134225945) is 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane].
What is the SMILES notation for 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
The canonical SMILES for 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] is COc1cc(C)cc2c1C1(CC1)CO2.
What is the InChIKey of 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
The InChIKey is LDKLTDPWDXZJAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-8-5-9(13-2)11-10(6-8)14-7-12(11)3-4-12/h5-6H,3-4,7H2,1-2H3.
What are the key properties of 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]?
4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] has a molecular weight of 190.24 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6-methylspiro[2H-1-benzofuran-3,1'-cyclopropane] is sourced from PubChem (CID 134225945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).