C63H120N3O2+ — CID 134226212
trimethyl-[6-[[(Z)-9-methylheptadec-11-enyl]-[(9Z,12Z)-octadeca-9,12-dienyl]amino]-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]azanium (PubChem CID 134226212) has the molecular formula C63H120N3O2+ and a molecular weight of 951.67 g/mol. Its IUPAC name is trimethyl-[6-[[(Z)-9-methylheptadec-11-enyl]-[(9Z,12Z)-octadeca-9,12-dienyl]amino]-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]azanium.
| Compound Name | trimethyl-[6-[[(Z)-9-methylheptadec-11-enyl]-[(9Z,12Z)-octadeca-9,12-dienyl]amino]-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]azanium |
|---|---|
| PubChem CID | 134226212 |
| Molecular Formula | C63H120N3O2+ |
| Molecular Weight | 951.67 g/mol |
| Exact Mass | 950.94 |
| IUPAC Name | trimethyl-[6-[[(Z)-9-methylheptadec-11-enyl]-[(9Z,12Z)-octadeca-9,12-dienyl]amino]-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]azanium |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCCC(C)C/C=C\CCCCC)C(=O)C(CCCC[N+](C)(C)C)NC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C63H119N3O2/c1-8-11-14-17-20-22-24-26-28-30-32-34-36-39-44-50-57-65(58-51-45-40-38-42-47-54-60(4)53-46-41-19-16-13-10-3)63(68)61(55-49-52-59-66(5,6)7)64-62(67)56-48-43-37-35-33-31-29-27-25-23-21-18-15-12-9-2/h20,22,26-29,41,46,60-61H,8-19,21,23-25,30-40,42-45,47-59H2,1-7H3/p+1/b22-20-,28-26-,29-27-,46-41- |
| InChIKey | BAHVXQWCRAULMD-DLTLZUMQSA-O |
| XLogP | 18.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.67 |
| LogP ≤ 5 | 18.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|