C44H29BrN4 — CID 134226256
2-[6-[4-(2-bromophenyl)phenyl]-3-pyridinyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine (PubChem CID 134226256) has the molecular formula C44H29BrN4 and a molecular weight of 693.65 g/mol. Its IUPAC name is 2-[6-[4-(2-bromophenyl)phenyl]-3-pyridinyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[6-[4-(2-bromophenyl)phenyl]-3-pyridinyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 134226256 |
| Molecular Formula | C44H29BrN4 |
| Molecular Weight | 693.65 g/mol |
| Exact Mass | 692.16 |
| IUPAC Name | 2-[6-[4-(2-bromophenyl)phenyl]-3-pyridinyl]-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
| SMILES | Brc1ccccc1-c1ccc(-c2ccc(-c3nc(-c4cccc(-c5ccccc5)c4)nc(-c4cccc(-c5ccccc5)c4)n3)cn2)cc1 |
| InChI | InChI=1S/C44H29BrN4/c45-40-20-8-7-19-39(40)32-21-23-33(24-22-32)41-26-25-38(29-46-41)44-48-42(36-17-9-15-34(27-36)30-11-3-1-4-12-30)47-43(49-44)37-18-10-16-35(28-37)31-13-5-2-6-14-31/h1-29H |
| InChIKey | MNKCLQSOFRAFFG-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.65 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |