About 4-chlorobenzenesulfinate;tetraethylazanium
4-chlorobenzenesulfinate;tetraethylazanium (PubChem CID 134226601) has the molecular formula C14H24ClNO2S
and a molecular weight of 305.87 g/mol. Its IUPAC name is 4-chlorobenzenesulfinate;tetraethylazanium.
Molecular Properties
| Compound Name | 4-chlorobenzenesulfinate;tetraethylazanium |
| PubChem CID | 134226601 |
| Molecular Formula | C14H24ClNO2S |
| Molecular Weight | 305.87 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-chlorobenzenesulfinate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S([O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H20N.C6H5ClO2S/c1-5-9(6-2,7-3)8-4;7-5-1-3-6(4-2-5)10(8)9/h5-8H2,1-4H3;1-4H,(H,8,9)/q+1;/p-1 |
| InChIKey | HLRSJFGEPWTQTK-UHFFFAOYSA-M |
| XLogP | 3.46 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobenzenesulfinate;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzenesulfinate;tetraethylazanium?
The IUPAC name of 4-chlorobenzenesulfinate;tetraethylazanium (CID 134226601) is 4-chlorobenzenesulfinate;tetraethylazanium.
What is the SMILES notation for 4-chlorobenzenesulfinate;tetraethylazanium?
The canonical SMILES for 4-chlorobenzenesulfinate;tetraethylazanium is CC[N+](CC)(CC)CC.O=S([O-])c1ccc(Cl)cc1.
What is the InChIKey of 4-chlorobenzenesulfinate;tetraethylazanium?
The InChIKey is HLRSJFGEPWTQTK-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.C6H5ClO2S/c1-5-9(6-2,7-3)8-4;7-5-1-3-6(4-2-5)10(8)9/h5-8H2,1-4H3;1-4H,(H,8,9)/q+1;/p-1.
What are the key properties of 4-chlorobenzenesulfinate;tetraethylazanium?
4-chlorobenzenesulfinate;tetraethylazanium has a molecular weight of 305.87 g/mol, XLogP of 3.46, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzenesulfinate;tetraethylazanium is sourced from PubChem (CID 134226601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).