About phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate
phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate (PubChem CID 134226740) has the molecular formula C14H9NO5S
and a molecular weight of 303.30 g/mol. Its IUPAC name is phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate.
Molecular Properties
| Compound Name | phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate |
| PubChem CID | 134226740 |
| Molecular Formula | C14H9NO5S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C14H9NO5S/c16-13-11-8-4-5-9-12(11)21(18,19)15(13)14(17)20-10-6-2-1-3-7-10/h1-9H |
| InChIKey | RIONGRJJGYJGNO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate?
The IUPAC name of phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate (CID 134226740) is phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate.
What is the SMILES notation for phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate?
The canonical SMILES for phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate is O=C(Oc1ccccc1)N1C(=O)c2ccccc2S1(=O)=O.
What is the InChIKey of phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate?
The InChIKey is RIONGRJJGYJGNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO5S/c16-13-11-8-4-5-9-12(11)21(18,19)15(13)14(17)20-10-6-2-1-3-7-10/h1-9H.
What are the key properties of phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate?
phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate has a molecular weight of 303.30 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate is sourced from PubChem (CID 134226740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).