C58H59ClN2 — CID 134227068
5-[2-[3-chloro-5-[2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-2-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine (PubChem CID 134227068) has the molecular formula C58H59ClN2 and a molecular weight of 819.58 g/mol. Its IUPAC name is 5-[2-[3-chloro-5-[2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-2-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine.
| Compound Name | 5-[2-[3-chloro-5-[2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-2-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine |
|---|---|
| PubChem CID | 134227068 |
| Molecular Formula | C58H59ClN2 |
| Molecular Weight | 819.58 g/mol |
| Exact Mass | 818.44 |
| IUPAC Name | 5-[2-[3-chloro-5-[2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]phenyl]phenyl]phenyl]-2-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine |
| SMILES | CC1(C)c2ccc(-c3ccc(-c4ccccc4-c4cc(Cl)cc(-c5ccccc5-c5ccc(-c6ccc7c(c6)C(C)(C)C(C)(C)C7(C)C)nc5)c4)cn3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C58H59ClN2/c1-53(2)47-25-21-36(32-49(47)55(5,6)57(53,9)10)51-27-23-38(34-60-51)43-17-13-15-19-45(43)40-29-41(31-42(59)30-40)46-20-16-14-18-44(46)39-24-28-52(61-35-39)37-22-26-48-50(33-37)56(7,8)58(11,12)54(48,3)4/h13-35H,1-12H3 |
| InChIKey | LHXRDBZDADCFKF-UHFFFAOYSA-N |
| XLogP | 16.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.58 |
| LogP ≤ 5 | 16.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |