C8H5F2NO2 — CID 134227179
(E)-3-(2,6-difluoro-3-pyridinyl)prop-2-enoic acid (PubChem CID 134227179) has the molecular formula C8H5F2NO2 and a molecular weight of 185.13 g/mol. Its IUPAC name is (E)-3-(2,6-difluoro-3-pyridinyl)prop-2-enoic acid.
| Compound Name | (E)-3-(2,6-difluoro-3-pyridinyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 134227179 |
| Molecular Formula | C8H5F2NO2 |
| Molecular Weight | 185.13 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | (E)-3-(2,6-difluoro-3-pyridinyl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(F)nc1F |
| InChI | InChI=1S/C8H5F2NO2/c9-6-3-1-5(8(10)11-6)2-4-7(12)13/h1-4H,(H,12,13)/b4-2+ |
| InChIKey | CIYRHMBOEFLPRX-DUXPYHPUSA-N |
| XLogP | 1.46 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.13 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|