C27H35N3O5 — CID 134227209
(E)-3-pyridin-3-yl-N-[4-[1-(2,4,6-trimethoxybenzoyl)piperidin-4-yl]butyl]prop-2-enamide (PubChem CID 134227209) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is (E)-3-pyridin-3-yl-N-[4-[1-(2,4,6-trimethoxybenzoyl)piperidin-4-yl]butyl]prop-2-enamide.
| Compound Name | (E)-3-pyridin-3-yl-N-[4-[1-(2,4,6-trimethoxybenzoyl)piperidin-4-yl]butyl]prop-2-enamide |
|---|---|
| PubChem CID | 134227209 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (E)-3-pyridin-3-yl-N-[4-[1-(2,4,6-trimethoxybenzoyl)piperidin-4-yl]butyl]prop-2-enamide |
| SMILES | COc1cc(OC)c(C(=O)N2CCC(CCCCNC(=O)/C=C/c3cccnc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C27H35N3O5/c1-33-22-17-23(34-2)26(24(18-22)35-3)27(32)30-15-11-20(12-16-30)7-4-5-14-29-25(31)10-9-21-8-6-13-28-19-21/h6,8-10,13,17-20H,4-5,7,11-12,14-16H2,1-3H3,(H,29,31)/b10-9+ |
| InChIKey | IHAUNHUVQINHQV-MDZDMXLPSA-N |
| XLogP | 3.96 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|