C21H20FN3O7 — CID 134227330
[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[5-(naphthalen-2-ylmethylcarbamoyl)-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] hypofluorite (PubChem CID 134227330) has the molecular formula C21H20FN3O7 and a molecular weight of 445.40 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[5-(naphthalen-2-ylmethylcarbamoyl)-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] hypofluorite.
| Compound Name | [(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[5-(naphthalen-2-ylmethylcarbamoyl)-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] hypofluorite |
|---|---|
| PubChem CID | 134227330 |
| Molecular Formula | C21H20FN3O7 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | [(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-[5-(naphthalen-2-ylmethylcarbamoyl)-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] hypofluorite |
| SMILES | O=C(NCc1ccc2ccccc2c1)c1cn([C@@H]2O[C@H](CO)[C@H](O)[C@H]2OF)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H20FN3O7/c22-32-17-16(27)15(10-26)31-20(17)25-9-14(19(29)24-21(25)30)18(28)23-8-11-5-6-12-3-1-2-4-13(12)7-11/h1-7,9,15-17,20,26-27H,8,10H2,(H,23,28)(H,24,29,30)/t15-,16+,17-,20-/m1/s1 |
| InChIKey | ORDQKFXUXPAAFH-AXVVYFOYSA-N |
| XLogP | 0.14 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |