About [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol
[5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol (PubChem CID 134227733) has the molecular formula C18H13Cl2NO
and a molecular weight of 330.21 g/mol. Its IUPAC name is [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol |
| PubChem CID | 134227733 |
| Molecular Formula | C18H13Cl2NO |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol |
| SMILES | OCc1ccc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H13Cl2NO/c19-14-5-1-12(2-6-14)17-10-9-16(11-22)21-18(17)13-3-7-15(20)8-4-13/h1-10,22H,11H2 |
| InChIKey | YCSYIOHOWRFLHX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol?
The IUPAC name of [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol (CID 134227733) is [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol.
What is the SMILES notation for [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol?
The canonical SMILES for [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol is OCc1ccc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)n1.
What is the InChIKey of [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol?
The InChIKey is YCSYIOHOWRFLHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2NO/c19-14-5-1-12(2-6-14)17-10-9-16(11-22)21-18(17)13-3-7-15(20)8-4-13/h1-10,22H,11H2.
What are the key properties of [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol?
[5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol has a molecular weight of 330.21 g/mol, XLogP of 5.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5,6-bis(4-chlorophenyl)-2-pyridinyl]methanol is sourced from PubChem (CID 134227733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).