About 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine
2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine (PubChem CID 134227737) has the molecular formula C26H22Cl2N4O3S
and a molecular weight of 541.46 g/mol. Its IUPAC name is 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine.
Molecular Properties
| Compound Name | 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine |
| PubChem CID | 134227737 |
| Molecular Formula | C26H22Cl2N4O3S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine |
| SMILES | COc1cccc(S(=O)(=O)N/C(N)=N/Cc2cnc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)c2)c1 |
| InChI | InChI=1S/C26H22Cl2N4O3S/c1-35-22-3-2-4-23(14-22)36(33,34)32-26(29)31-16-17-13-24(18-5-9-20(27)10-6-18)25(30-15-17)19-7-11-21(28)12-8-19/h2-15H,16H2,1H3,(H3,29,31,32) |
| InChIKey | BEVAFYBOJWYASK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine?
The IUPAC name of 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine (CID 134227737) is 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine.
What is the SMILES notation for 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine?
The canonical SMILES for 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine is COc1cccc(S(=O)(=O)N/C(N)=N/Cc2cnc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)c2)c1.
What is the InChIKey of 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine?
The InChIKey is BEVAFYBOJWYASK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22Cl2N4O3S/c1-35-22-3-2-4-23(14-22)36(33,34)32-26(29)31-16-17-13-24(18-5-9-20(27)10-6-18)25(30-15-17)19-7-11-21(28)12-8-19/h2-15H,16H2,1H3,(H3,29,31,32).
What are the key properties of 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine?
2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine has a molecular weight of 541.46 g/mol, XLogP of 5.52, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5,6-bis(4-chlorophenyl)-3-pyridinyl]methyl]-1-(3-methoxyphenyl)sulfonylguanidine is sourced from PubChem (CID 134227737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).