C12H19N — CID 134228472
7-propan-2-yl-2,3,4,9a-tetrahydro-1H-quinolizine (PubChem CID 134228472) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 7-propan-2-yl-2,3,4,9a-tetrahydro-1H-quinolizine.
| Compound Name | 7-propan-2-yl-2,3,4,9a-tetrahydro-1H-quinolizine |
|---|---|
| PubChem CID | 134228472 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 7-propan-2-yl-2,3,4,9a-tetrahydro-1H-quinolizine |
| SMILES | CC(C)C1=CN2CCCCC2C=C1 |
| InChI | InChI=1S/C12H19N/c1-10(2)11-6-7-12-5-3-4-8-13(12)9-11/h6-7,9-10,12H,3-5,8H2,1-2H3 |
| InChIKey | MVPWTXDWESGCTA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |