C17H25NO3 — CID 134228842
(E)-3-[[(3E,4Z)-3-ethylidene-5-methylhepta-4,6-dien-2-ylidene]amino]-4-hydroxy-2,4-dimethylpent-2-enoic acid (PubChem CID 134228842) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (E)-3-[[(3E,4Z)-3-ethylidene-5-methylhepta-4,6-dien-2-ylidene]amino]-4-hydroxy-2,4-dimethylpent-2-enoic acid.
| Compound Name | (E)-3-[[(3E,4Z)-3-ethylidene-5-methylhepta-4,6-dien-2-ylidene]amino]-4-hydroxy-2,4-dimethylpent-2-enoic acid |
|---|---|
| PubChem CID | 134228842 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (E)-3-[[(3E,4Z)-3-ethylidene-5-methylhepta-4,6-dien-2-ylidene]amino]-4-hydroxy-2,4-dimethylpent-2-enoic acid |
| SMILES | C=C/C(C)=C\C(=C/C)\C(C)=N\C(=C(/C)C(=O)O)C(C)(C)O |
| InChI | InChI=1S/C17H25NO3/c1-8-11(3)10-14(9-2)13(5)18-15(17(6,7)21)12(4)16(19)20/h8-10,21H,1H2,2-7H3,(H,19,20)/b11-10-,14-9+,15-12+,18-13+ |
| InChIKey | UJIUBQSYMJTOOT-UKQXIERCSA-N |
| XLogP | 3.66 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|