About 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine
5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine (PubChem CID 134228861) has the molecular formula C9H12BrFN2
and a molecular weight of 247.11 g/mol. Its IUPAC name is 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine |
| PubChem CID | 134228861 |
| Molecular Formula | C9H12BrFN2 |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine |
| SMILES | CC(C)Nc1cc(Br)cc(F)c1N |
| InChI | InChI=1S/C9H12BrFN2/c1-5(2)13-8-4-6(10)3-7(11)9(8)12/h3-5,13H,12H2,1-2H3 |
| InChIKey | CIBDMJBMTHODJH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine?
The IUPAC name of 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine (CID 134228861) is 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine.
What is the SMILES notation for 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine?
The canonical SMILES for 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine is CC(C)Nc1cc(Br)cc(F)c1N.
What is the InChIKey of 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine?
The InChIKey is CIBDMJBMTHODJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrFN2/c1-5(2)13-8-4-6(10)3-7(11)9(8)12/h3-5,13H,12H2,1-2H3.
What are the key properties of 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine?
5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine has a molecular weight of 247.11 g/mol, XLogP of 2.99, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-fluoro-1-N-propan-2-ylbenzene-1,2-diamine is sourced from PubChem (CID 134228861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).