C14H18ClNO2 — CID 134228862
(E)-3-[[(3E,5E)-5-chloro-3-ethenylhepta-3,5-dien-2-ylidene]amino]-2-methylbut-2-enoic acid (PubChem CID 134228862) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is (E)-3-[[(3E,5E)-5-chloro-3-ethenylhepta-3,5-dien-2-ylidene]amino]-2-methylbut-2-enoic acid.
| Compound Name | (E)-3-[[(3E,5E)-5-chloro-3-ethenylhepta-3,5-dien-2-ylidene]amino]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 134228862 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (E)-3-[[(3E,5E)-5-chloro-3-ethenylhepta-3,5-dien-2-ylidene]amino]-2-methylbut-2-enoic acid |
| SMILES | C=CC(=C\C(Cl)=C/C)/C(C)=N\C(C)=C(/C)C(=O)O |
| InChI | InChI=1S/C14H18ClNO2/c1-6-12(8-13(15)7-2)11(5)16-10(4)9(3)14(17)18/h6-8H,1H2,2-5H3,(H,17,18)/b10-9+,12-8+,13-7+,16-11+ |
| InChIKey | LNPKLOLXSCKCND-KJHQIRSJSA-N |
| XLogP | 4.08 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|