C16H23NO — CID 134228902
(3E,5Z)-3-ethenyl-N-[(1E)-3-ethoxy-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine (PubChem CID 134228902) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-N-[(1E)-3-ethoxy-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine.
| Compound Name | (3E,5Z)-3-ethenyl-N-[(1E)-3-ethoxy-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 134228902 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (3E,5Z)-3-ethenyl-N-[(1E)-3-ethoxy-2-methylbuta-1,3-dienyl]hepta-3,5-dien-2-imine |
| SMILES | C=CC(=C\C=C/C)/C(C)=N/C=C(\C)C(=C)OCC |
| InChI | InChI=1S/C16H23NO/c1-7-10-11-16(8-2)14(5)17-12-13(4)15(6)18-9-3/h7-8,10-12H,2,6,9H2,1,3-5H3/b10-7-,13-12+,16-11+,17-14+ |
| InChIKey | XYVATSSUZJYDHJ-MKURWRAZSA-N |
| XLogP | 4.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|