About (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one
(E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one (PubChem CID 134228945) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one.
Molecular Properties
| Compound Name | (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one |
| PubChem CID | 134228945 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one |
| SMILES | C=CC(=C\C=C/C)/C(C)=N/C(C)=C(\C)C(C)=O |
| InChI | InChI=1S/C15H21NO/c1-7-9-10-15(8-2)13(5)16-12(4)11(3)14(6)17/h7-10H,2H2,1,3-6H3/b9-7-,12-11+,15-10+,16-13+ |
| InChIKey | HSEVGYQAYKPFGN-MPDSAEIVSA-N |
| XLogP | 4.02 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one?
The IUPAC name of (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one (CID 134228945) is (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one.
What is the SMILES notation for (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one?
The canonical SMILES for (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one is C=CC(=C\C=C/C)/C(C)=N/C(C)=C(\C)C(C)=O.
What is the InChIKey of (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one?
The InChIKey is HSEVGYQAYKPFGN-MPDSAEIVSA-N. The full InChI is InChI=1S/C15H21NO/c1-7-9-10-15(8-2)13(5)16-12(4)11(3)14(6)17/h7-10H,2H2,1,3-6H3/b9-7-,12-11+,15-10+,16-13+.
What are the key properties of (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one?
(E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one has a molecular weight of 231.34 g/mol, XLogP of 4.02, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[[(3E,5Z)-3-ethenylhepta-3,5-dien-2-ylidene]amino]-3-methylpent-3-en-2-one is sourced from PubChem (CID 134228945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).