C37H35F — CID 134228994
1,4-bis[(1Z)-buta-1,3-dienyl]-2,3,3'-tris(ethenyl)-2'-[(1E)-2-fluorobuta-1,3-dienyl]-4',5'-bis[(Z)-prop-1-enyl]spiro[cyclopenta-1,3-diene-5,1'-indene] (PubChem CID 134228994) has the molecular formula C37H35F and a molecular weight of 498.69 g/mol. Its IUPAC name is 1,4-bis[(1Z)-buta-1,3-dienyl]-2,3,3'-tris(ethenyl)-2'-[(1E)-2-fluorobuta-1,3-dienyl]-4',5'-bis[(Z)-prop-1-enyl]spiro[cyclopenta-1,3-diene-5,1'-indene].
| Compound Name | 1,4-bis[(1Z)-buta-1,3-dienyl]-2,3,3'-tris(ethenyl)-2'-[(1E)-2-fluorobuta-1,3-dienyl]-4',5'-bis[(Z)-prop-1-enyl]spiro[cyclopenta-1,3-diene-5,1'-indene] |
|---|---|
| PubChem CID | 134228994 |
| Molecular Formula | C37H35F |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 1,4-bis[(1Z)-buta-1,3-dienyl]-2,3,3'-tris(ethenyl)-2'-[(1E)-2-fluorobuta-1,3-dienyl]-4',5'-bis[(Z)-prop-1-enyl]spiro[cyclopenta-1,3-diene-5,1'-indene] |
| SMILES | C=C/C=C\C1=C(C=C)C(C=C)=C(/C=C\C=C)C12C(/C=C(/F)C=C)=C(C=C)c1c2ccc(/C=C\C)c1/C=C\C |
| InChI | InChI=1S/C37H35F/c1-9-17-21-32-28(14-6)29(15-7)33(22-18-10-2)37(32)34-24-23-26(19-11-3)31(20-12-4)36(34)30(16-8)35(37)25-27(38)13-5/h9-25H,1-2,5-8H2,3-4H3/b19-11-,20-12-,21-17-,22-18-,27-25+ |
| InChIKey | AFGIRUSDOXBQGB-VIUHLWMQSA-N |
| XLogP | 10.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|