About [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate
[3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate (PubChem CID 13422912) has the molecular formula C19H10N2O4S
and a molecular weight of 362.37 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate.
Molecular Properties
| Compound Name | [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate |
| PubChem CID | 13422912 |
| Molecular Formula | C19H10N2O4S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(C#N)c(-c3nc4ccccc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H10N2O4S/c1-10(22)24-11-6-7-12-13(9-20)17(19(23)25-15(12)8-11)18-21-14-4-2-3-5-16(14)26-18/h2-8H,1H3 |
| InChIKey | BKZFWMZLNOTFDK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 93.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate?
The IUPAC name of [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate (CID 13422912) is [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate.
What is the SMILES notation for [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate?
The canonical SMILES for [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate is CC(=O)Oc1ccc2c(C#N)c(-c3nc4ccccc4s3)c(=O)oc2c1.
What is the InChIKey of [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate?
The InChIKey is BKZFWMZLNOTFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10N2O4S/c1-10(22)24-11-6-7-12-13(9-20)17(19(23)25-15(12)8-11)18-21-14-4-2-3-5-16(14)26-18/h2-8H,1H3.
What are the key properties of [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate?
[3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate has a molecular weight of 362.37 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-benzothiazol-2-yl)-4-cyano-2-oxochromen-7-yl] acetate is sourced from PubChem (CID 13422912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).