C22H19FN6O7 — CID 134229799
[(2R,3R,4R,5R)-4-acetyloxy-5-(6-amino-2-fluoropurin-9-yl)-2-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-3-yl] acetate (PubChem CID 134229799) has the molecular formula C22H19FN6O7 and a molecular weight of 498.43 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-5-(6-amino-2-fluoropurin-9-yl)-2-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(6-amino-2-fluoropurin-9-yl)-2-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 134229799 |
| Molecular Formula | C22H19FN6O7 |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-5-(6-amino-2-fluoropurin-9-yl)-2-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](CN2C(=O)c3ccccc3C2=O)O[C@H]1n1cnc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C22H19FN6O7/c1-9(30)34-15-13(7-28-19(32)11-5-3-4-6-12(11)20(28)33)36-21(16(15)35-10(2)31)29-8-25-14-17(24)26-22(23)27-18(14)29/h3-6,8,13,15-16,21H,7H2,1-2H3,(H2,24,26,27)/t13-,15-,16-,21-/m1/s1 |
| InChIKey | LPLUOXBBKHWGSJ-GJDPQZJCSA-N |
| XLogP | 0.60 |
| TPSA | 168.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|