C11H17FN6O3S — CID 134229805
(2R,3R,4S,5S)-2-(6,6-diamino-2-fluoro-8H-purin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol (PubChem CID 134229805) has the molecular formula C11H17FN6O3S and a molecular weight of 332.36 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(6,6-diamino-2-fluoro-8H-purin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(6,6-diamino-2-fluoro-8H-purin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 134229805 |
| Molecular Formula | C11H17FN6O3S |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (2R,3R,4S,5S)-2-(6,6-diamino-2-fluoro-8H-purin-9-yl)-5-(methylsulfanylmethyl)oxolane-3,4-diol |
| SMILES | CSC[C@H]1O[C@@H](N2CN=C3C2=NC(F)=NC3(N)N)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H17FN6O3S/c1-22-2-4-5(19)6(20)9(21-4)18-3-15-7-8(18)16-10(12)17-11(7,13)14/h4-6,9,19-20H,2-3,13-14H2,1H3/t4-,5-,6-,9-/m1/s1 |
| InChIKey | CGQWPHZIVKGBDR-MWKIOEHESA-N |
| XLogP | -2.18 |
| TPSA | 142.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|