About oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate
oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate (PubChem CID 134229836) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate.
Molecular Properties
| Compound Name | oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate |
| PubChem CID | 134229836 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate |
| SMILES | C=CCOCC(=C)C(=O)OC1CCCO1 |
| InChI | InChI=1S/C11H16O4/c1-3-6-13-8-9(2)11(12)15-10-5-4-7-14-10/h3,10H,1-2,4-8H2 |
| InChIKey | ROIBLDFQGAUHBD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate?
The IUPAC name of oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate (CID 134229836) is oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate.
What is the SMILES notation for oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate?
The canonical SMILES for oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate is C=CCOCC(=C)C(=O)OC1CCCO1.
What is the InChIKey of oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate?
The InChIKey is ROIBLDFQGAUHBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4/c1-3-6-13-8-9(2)11(12)15-10-5-4-7-14-10/h3,10H,1-2,4-8H2.
What are the key properties of oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate?
oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate has a molecular weight of 212.24 g/mol, XLogP of 1.42, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-yl 2-(prop-2-enoxymethyl)prop-2-enoate is sourced from PubChem (CID 134229836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).