About 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine
2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine (PubChem CID 134231010) has the molecular formula C26H35N3O2
and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine |
| PubChem CID | 134231010 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine |
| SMILES | COc1ccc(-c2[nH]c3ccc(C4CCN(CCN)CC4)cc3c2C(C)C)cc1OC |
| InChI | InChI=1S/C26H35N3O2/c1-17(2)25-21-15-19(18-9-12-29(13-10-18)14-11-27)5-7-22(21)28-26(25)20-6-8-23(30-3)24(16-20)31-4/h5-8,15-18,28H,9-14,27H2,1-4H3 |
| InChIKey | QJRGCCFRZAEAFG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine?
The IUPAC name of 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine (CID 134231010) is 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine.
What is the SMILES notation for 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine?
The canonical SMILES for 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine is COc1ccc(-c2[nH]c3ccc(C4CCN(CCN)CC4)cc3c2C(C)C)cc1OC.
What is the InChIKey of 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine?
The InChIKey is QJRGCCFRZAEAFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35N3O2/c1-17(2)25-21-15-19(18-9-12-29(13-10-18)14-11-27)5-7-22(21)28-26(25)20-6-8-23(30-3)24(16-20)31-4/h5-8,15-18,28H,9-14,27H2,1-4H3.
What are the key properties of 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine?
2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine has a molecular weight of 421.59 g/mol, XLogP of 5.11, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]ethanamine is sourced from PubChem (CID 134231010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).