C27H32N4O3 — CID 134231138
2-[[2-[4-[2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indol-5-yl]piperidin-1-yl]-2-oxoethyl]amino]acetonitrile (PubChem CID 134231138) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-[[2-[4-[2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indol-5-yl]piperidin-1-yl]-2-oxoethyl]amino]acetonitrile.
| Compound Name | 2-[[2-[4-[2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indol-5-yl]piperidin-1-yl]-2-oxoethyl]amino]acetonitrile |
|---|---|
| PubChem CID | 134231138 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 2-[[2-[4-[2-(3,4-dimethoxyphenyl)-3-ethyl-1H-indol-5-yl]piperidin-1-yl]-2-oxoethyl]amino]acetonitrile |
| SMILES | CCc1c(-c2ccc(OC)c(OC)c2)[nH]c2ccc(C3CCN(C(=O)CNCC#N)CC3)cc12 |
| InChI | InChI=1S/C27H32N4O3/c1-4-21-22-15-19(18-9-13-31(14-10-18)26(32)17-29-12-11-28)5-7-23(22)30-27(21)20-6-8-24(33-2)25(16-20)34-3/h5-8,15-16,18,29-30H,4,9-10,12-14,17H2,1-3H3 |
| InChIKey | DFJVYARGIMEANF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|