C17H29N — CID 134232119
9-tert-butyl-9-methyl-4a,5,6,7,8,10,11,11a-octahydrocyclonona[c]pyridine (PubChem CID 134232119) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 9-tert-butyl-9-methyl-4a,5,6,7,8,10,11,11a-octahydrocyclonona[c]pyridine.
| Compound Name | 9-tert-butyl-9-methyl-4a,5,6,7,8,10,11,11a-octahydrocyclonona[c]pyridine |
|---|---|
| PubChem CID | 134232119 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 9-tert-butyl-9-methyl-4a,5,6,7,8,10,11,11a-octahydrocyclonona[c]pyridine |
| SMILES | CC(C)(C)C1(C)CCCCC2C=CN=CC2CC1 |
| InChI | InChI=1S/C17H29N/c1-16(2,3)17(4)10-6-5-7-14-9-12-18-13-15(14)8-11-17/h9,12-15H,5-8,10-11H2,1-4H3 |
| InChIKey | QSNZTOVXLTVEKJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |