C18H26N2O — CID 134232623
3-ethyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]hex-5-en-1-amine (PubChem CID 134232623) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-ethyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]hex-5-en-1-amine.
| Compound Name | 3-ethyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]hex-5-en-1-amine |
|---|---|
| PubChem CID | 134232623 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-ethyl-N-[(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]hex-5-en-1-amine |
| SMILES | C=CCC(CC)CCNCC1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C18H26N2O/c1-3-8-15(4-2)11-12-19-14-17-13-18(20-21-17)16-9-6-5-7-10-16/h3,5-7,9-10,15,17,19H,1,4,8,11-14H2,2H3 |
| InChIKey | OYEYCJVYDRBQAG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|