About 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine
3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine (PubChem CID 134232636) has the molecular formula C18H27N3S2
and a molecular weight of 349.57 g/mol. Its IUPAC name is 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine.
Molecular Properties
| Compound Name | 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine |
| PubChem CID | 134232636 |
| Molecular Formula | C18H27N3S2 |
| Molecular Weight | 349.57 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine |
| SMILES | C=CCC(CC)CCN(Cc1cnc(C)s1)Cc1cnc(C)s1 |
| InChI | InChI=1S/C18H27N3S2/c1-5-7-16(6-2)8-9-21(12-17-10-19-14(3)22-17)13-18-11-20-15(4)23-18/h5,10-11,16H,1,6-9,12-13H2,2-4H3 |
| InChIKey | XFSBDEKRZMQFLI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine?
The IUPAC name of 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine (CID 134232636) is 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine.
What is the SMILES notation for 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine?
The canonical SMILES for 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine is C=CCC(CC)CCN(Cc1cnc(C)s1)Cc1cnc(C)s1.
What is the InChIKey of 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine?
The InChIKey is XFSBDEKRZMQFLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3S2/c1-5-7-16(6-2)8-9-21(12-17-10-19-14(3)22-17)13-18-11-20-15(4)23-18/h5,10-11,16H,1,6-9,12-13H2,2-4H3.
What are the key properties of 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine?
3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine has a molecular weight of 349.57 g/mol, XLogP of 5.21, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N,N-bis[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-en-1-amine is sourced from PubChem (CID 134232636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).