About 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine
3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine (PubChem CID 134232679) has the molecular formula C15H21NOS
and a molecular weight of 263.41 g/mol. Its IUPAC name is 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine.
Molecular Properties
| Compound Name | 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine |
| PubChem CID | 134232679 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine |
| SMILES | C=CCC(CC)CCNCc1cc2ccoc2s1 |
| InChI | InChI=1S/C15H21NOS/c1-3-5-12(4-2)6-8-16-11-14-10-13-7-9-17-15(13)18-14/h3,7,9-10,12,16H,1,4-6,8,11H2,2H3 |
| InChIKey | MNYJVGSABOFMPG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine?
The IUPAC name of 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine (CID 134232679) is 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine.
What is the SMILES notation for 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine?
The canonical SMILES for 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine is C=CCC(CC)CCNCc1cc2ccoc2s1.
What is the InChIKey of 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine?
The InChIKey is MNYJVGSABOFMPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NOS/c1-3-5-12(4-2)6-8-16-11-14-10-13-7-9-17-15(13)18-14/h3,7,9-10,12,16H,1,4-6,8,11H2,2H3.
What are the key properties of 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine?
3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine has a molecular weight of 263.41 g/mol, XLogP of 4.58, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N-(thieno[2,3-b]furan-5-ylmethyl)hex-5-en-1-amine is sourced from PubChem (CID 134232679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).