C45H35FO6S — CID 134233263
[(2R,3S,4R)-4-fluoro-3-(4-phenylbenzoyl)oxy-5-[(4-phenylbenzoyl)oxymethyl]thiolan-2-yl]methyl 4-phenylbenzoate (PubChem CID 134233263) has the molecular formula C45H35FO6S and a molecular weight of 722.83 g/mol. Its IUPAC name is [(2R,3S,4R)-4-fluoro-3-(4-phenylbenzoyl)oxy-5-[(4-phenylbenzoyl)oxymethyl]thiolan-2-yl]methyl 4-phenylbenzoate.
| Compound Name | [(2R,3S,4R)-4-fluoro-3-(4-phenylbenzoyl)oxy-5-[(4-phenylbenzoyl)oxymethyl]thiolan-2-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 134233263 |
| Molecular Formula | C45H35FO6S |
| Molecular Weight | 722.83 g/mol |
| Exact Mass | 722.21 |
| IUPAC Name | [(2R,3S,4R)-4-fluoro-3-(4-phenylbenzoyl)oxy-5-[(4-phenylbenzoyl)oxymethyl]thiolan-2-yl]methyl 4-phenylbenzoate |
| SMILES | O=C(OCC1S[C@H](COC(=O)c2ccc(-c3ccccc3)cc2)[C@@H](OC(=O)c2ccc(-c3ccccc3)cc2)[C@H]1F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C45H35FO6S/c46-41-39(28-50-43(47)36-22-16-33(17-23-36)30-10-4-1-5-11-30)53-40(29-51-44(48)37-24-18-34(19-25-37)31-12-6-2-7-13-31)42(41)52-45(49)38-26-20-35(21-27-38)32-14-8-3-9-15-32/h1-27,39-42H,28-29H2/t39?,40-,41+,42-/m1/s1 |
| InChIKey | FIRSLYAEZXQOLE-OHMWMVFQSA-N |
| XLogP | 9.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.83 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|