About 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one
1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one (PubChem CID 134233347) has the molecular formula C16H29NO
and a molecular weight of 251.41 g/mol. Its IUPAC name is 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one.
Molecular Properties
| Compound Name | 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one |
| PubChem CID | 134233347 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one |
| SMILES | C=CCC(CC)(CC)C(=O)N1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H29NO/c1-6-9-16(7-2,8-3)14(18)17-12-10-15(4,5)11-13-17/h6H,1,7-13H2,2-5H3 |
| InChIKey | YPYANHQVANOSTQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one?
The IUPAC name of 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one (CID 134233347) is 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one.
What is the SMILES notation for 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one?
The canonical SMILES for 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one is C=CCC(CC)(CC)C(=O)N1CCC(C)(C)CC1.
What is the InChIKey of 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one?
The InChIKey is YPYANHQVANOSTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO/c1-6-9-16(7-2,8-3)14(18)17-12-10-15(4,5)11-13-17/h6H,1,7-13H2,2-5H3.
What are the key properties of 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one?
1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one has a molecular weight of 251.41 g/mol, XLogP of 4.02, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-dimethylpiperidin-1-yl)-2,2-diethylpent-4-en-1-one is sourced from PubChem (CID 134233347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).