(2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid

C7H8N2O2 — CID 134233755

IUPAC(2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid
SMILES[H]/N=C/C=C(/C=C/C(=O)O)\C=N\[H]
InChIInChI=1S/C7H8N2O2/c8-4-3-6(5-9)1-2-7(10)11/h1-5,8-9H,(H,10,11)/b2-1+,6-3-,8-4+,9-5+
InChIKeyLEBICIRCADVVGS-ZRXZOPPOSA-N
MW152.15 g/mol
LogP0.85
Rot. Bonds4

About (2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid

(2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid (PubChem CID 134233755) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is (2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid.

Molecular Properties

Compound Name(2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid
PubChem CID134233755
Molecular FormulaC7H8N2O2
Molecular Weight152.15 g/mol
Exact Mass152.06
IUPAC Name(2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid
SMILES[H]/N=C/C=C(/C=C/C(=O)O)\C=N\[H]
InChIInChI=1S/C7H8N2O2/c8-4-3-6(5-9)1-2-7(10)11/h1-5,8-9H,(H,10,11)/b2-1+,6-3-,8-4+,9-5+
InChIKeyLEBICIRCADVVGS-ZRXZOPPOSA-N
XLogP0.85
TPSA85.00 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.15
LogP ≤ 50.85
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid?
The IUPAC name of (2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid (CID 134233755) is (2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid.
What is the SMILES notation for (2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid?
The canonical SMILES for (2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid is [H]/N=C/C=C(/C=C/C(=O)O)\C=N\[H].
What is the InChIKey of (2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid?
The InChIKey is LEBICIRCADVVGS-ZRXZOPPOSA-N. The full InChI is InChI=1S/C7H8N2O2/c8-4-3-6(5-9)1-2-7(10)11/h1-5,8-9H,(H,10,11)/b2-1+,6-3-,8-4+,9-5+.
What are the key properties of (2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid?
(2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid has a molecular weight of 152.15 g/mol, XLogP of 0.85, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-6-imino-4-methanimidoylhexa-2,4-dienoic acid is sourced from PubChem (CID 134233755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).